C18H20O3 — CID 10517184
(E,1S,2S)-5-(4-methoxyphenyl)-1-phenylpent-4-ene-1,2-diol (PubChem CID 10517184) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is (E,1S,2S)-5-(4-methoxyphenyl)-1-phenylpent-4-ene-1,2-diol.
| Compound Name | (E,1S,2S)-5-(4-methoxyphenyl)-1-phenylpent-4-ene-1,2-diol |
|---|---|
| PubChem CID | 10517184 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (E,1S,2S)-5-(4-methoxyphenyl)-1-phenylpent-4-ene-1,2-diol |
| SMILES | COc1ccc(/C=C/C[C@H](O)[C@@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H20O3/c1-21-16-12-10-14(11-13-16)6-5-9-17(19)18(20)15-7-3-2-4-8-15/h2-8,10-13,17-20H,9H2,1H3/b6-5+/t17-,18-/m0/s1 |
| InChIKey | UIODFVIXHONPMT-ZBKUBXTQSA-N |
| XLogP | 3.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |