C19H22O2 — CID 58883202
(E,2S,3R)-3-methyl-6-(4-phenoxyphenyl)hex-5-en-2-ol (PubChem CID 58883202) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (E,2S,3R)-3-methyl-6-(4-phenoxyphenyl)hex-5-en-2-ol.
| Compound Name | (E,2S,3R)-3-methyl-6-(4-phenoxyphenyl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 58883202 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (E,2S,3R)-3-methyl-6-(4-phenoxyphenyl)hex-5-en-2-ol |
| SMILES | C[C@H](O)[C@H](C)C/C=C/c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H22O2/c1-15(16(2)20)7-6-8-17-11-13-19(14-12-17)21-18-9-4-3-5-10-18/h3-6,8-16,20H,7H2,1-2H3/b8-6+/t15-,16+/m1/s1 |
| InChIKey | UURBSNWBNMOPQA-DODUIYEKSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |