About but-1-enylbenzene;phenoxybenzene
but-1-enylbenzene;phenoxybenzene (PubChem CID 175609674) has the molecular formula C22H22O
and a molecular weight of 302.42 g/mol. Its IUPAC name is but-1-enylbenzene;phenoxybenzene.
Molecular Properties
| Compound Name | but-1-enylbenzene;phenoxybenzene |
| PubChem CID | 175609674 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | but-1-enylbenzene;phenoxybenzene |
| SMILES | CCC=Cc1ccccc1.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C10H12/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-7-10-8-5-4-6-9-10/h1-10H;3-9H,2H2,1H3 |
| InChIKey | NUPRITJVMDTLJL-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze but-1-enylbenzene;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-enylbenzene;phenoxybenzene?
The IUPAC name of but-1-enylbenzene;phenoxybenzene (CID 175609674) is but-1-enylbenzene;phenoxybenzene.
What is the SMILES notation for but-1-enylbenzene;phenoxybenzene?
The canonical SMILES for but-1-enylbenzene;phenoxybenzene is CCC=Cc1ccccc1.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of but-1-enylbenzene;phenoxybenzene?
The InChIKey is NUPRITJVMDTLJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C10H12/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-7-10-8-5-4-6-9-10/h1-10H;3-9H,2H2,1H3.
What are the key properties of but-1-enylbenzene;phenoxybenzene?
but-1-enylbenzene;phenoxybenzene has a molecular weight of 302.42 g/mol, XLogP of 6.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-enylbenzene;phenoxybenzene is sourced from PubChem (CID 175609674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).