About acetyloxysilyl acetate;but-1-enylbenzene
acetyloxysilyl acetate;but-1-enylbenzene (PubChem CID 174652412) has the molecular formula C14H20O4Si
and a molecular weight of 280.40 g/mol. Its IUPAC name is acetyloxysilyl acetate;but-1-enylbenzene.
Molecular Properties
| Compound Name | acetyloxysilyl acetate;but-1-enylbenzene |
| PubChem CID | 174652412 |
| Molecular Formula | C14H20O4Si |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | acetyloxysilyl acetate;but-1-enylbenzene |
| SMILES | CC(=O)O[SiH2]OC(C)=O.CCC=Cc1ccccc1 |
| InChI | InChI=1S/C10H12.C4H8O4Si/c1-2-3-7-10-8-5-4-6-9-10;1-3(5)7-9-8-4(2)6/h3-9H,2H2,1H3;9H2,1-2H3 |
| InChIKey | JNOQNNAXQXXSJD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetyloxysilyl acetate;but-1-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyloxysilyl acetate;but-1-enylbenzene?
The IUPAC name of acetyloxysilyl acetate;but-1-enylbenzene (CID 174652412) is acetyloxysilyl acetate;but-1-enylbenzene.
What is the SMILES notation for acetyloxysilyl acetate;but-1-enylbenzene?
The canonical SMILES for acetyloxysilyl acetate;but-1-enylbenzene is CC(=O)O[SiH2]OC(C)=O.CCC=Cc1ccccc1.
What is the InChIKey of acetyloxysilyl acetate;but-1-enylbenzene?
The InChIKey is JNOQNNAXQXXSJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C4H8O4Si/c1-2-3-7-10-8-5-4-6-9-10;1-3(5)7-9-8-4(2)6/h3-9H,2H2,1H3;9H2,1-2H3.
What are the key properties of acetyloxysilyl acetate;but-1-enylbenzene?
acetyloxysilyl acetate;but-1-enylbenzene has a molecular weight of 280.40 g/mol, XLogP of 2.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetyloxysilyl acetate;but-1-enylbenzene is sourced from PubChem (CID 174652412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).