C33H32O7 — CID 101138995
(3R,4R,5S)-3-[(R)-(3,4-dimethoxyphenyl)-hydroxymethyl]-4-hydroxy-5-(trityloxymethyl)oxolan-2-one (PubChem CID 101138995) has the molecular formula C33H32O7 and a molecular weight of 540.61 g/mol. Its IUPAC name is (3R,4R,5S)-3-[(R)-(3,4-dimethoxyphenyl)-hydroxymethyl]-4-hydroxy-5-(trityloxymethyl)oxolan-2-one.
| Compound Name | (3R,4R,5S)-3-[(R)-(3,4-dimethoxyphenyl)-hydroxymethyl]-4-hydroxy-5-(trityloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 101138995 |
| Molecular Formula | C33H32O7 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | (3R,4R,5S)-3-[(R)-(3,4-dimethoxyphenyl)-hydroxymethyl]-4-hydroxy-5-(trityloxymethyl)oxolan-2-one |
| SMILES | COc1ccc([C@H](O)[C@H]2C(=O)O[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H]2O)cc1OC |
| InChI | InChI=1S/C33H32O7/c1-37-26-19-18-22(20-27(26)38-2)30(34)29-31(35)28(40-32(29)36)21-39-33(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-20,28-31,34-35H,21H2,1-2H3/t28-,29+,30-,31-/m0/s1 |
| InChIKey | BXXKLGNFGAFXFR-JVVMDBNWSA-N |
| XLogP | 4.65 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|