C31H36O5 — CID 163074925
4-hydroxy-3-(1-hydroxyhexyl)-6-(trityloxymethyl)oxan-2-one (PubChem CID 163074925) has the molecular formula C31H36O5 and a molecular weight of 488.62 g/mol. Its IUPAC name is 4-hydroxy-3-(1-hydroxyhexyl)-6-(trityloxymethyl)oxan-2-one.
| Compound Name | 4-hydroxy-3-(1-hydroxyhexyl)-6-(trityloxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 163074925 |
| Molecular Formula | C31H36O5 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 4-hydroxy-3-(1-hydroxyhexyl)-6-(trityloxymethyl)oxan-2-one |
| SMILES | CCCCCC(O)C1C(=O)OC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1O |
| InChI | InChI=1S/C31H36O5/c1-2-3-7-20-27(32)29-28(33)21-26(36-30(29)34)22-35-31(23-14-8-4-9-15-23,24-16-10-5-11-17-24)25-18-12-6-13-19-25/h4-6,8-19,26-29,32-33H,2-3,7,20-22H2,1H3 |
| InChIKey | CSWSHVJJINCRMZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|