C30H36O3 — CID 53247789
(1R)-1-[(1R,2R)-2-(trityloxymethyl)cyclopropyl]heptane-1,7-diol (PubChem CID 53247789) has the molecular formula C30H36O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is (1R)-1-[(1R,2R)-2-(trityloxymethyl)cyclopropyl]heptane-1,7-diol.
| Compound Name | (1R)-1-[(1R,2R)-2-(trityloxymethyl)cyclopropyl]heptane-1,7-diol |
|---|---|
| PubChem CID | 53247789 |
| Molecular Formula | C30H36O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (1R)-1-[(1R,2R)-2-(trityloxymethyl)cyclopropyl]heptane-1,7-diol |
| SMILES | OCCCCCC[C@@H](O)[C@@H]1C[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H36O3/c31-21-13-2-1-12-20-29(32)28-22-24(28)23-33-30(25-14-6-3-7-15-25,26-16-8-4-9-17-26)27-18-10-5-11-19-27/h3-11,14-19,24,28-29,31-32H,1-2,12-13,20-23H2/t24-,28+,29+/m0/s1 |
| InChIKey | DBHUKUFBHFORKR-TUMTZTIRSA-N |
| XLogP | 5.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|