C32H42O3Si — CID 101470588
[(1R,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(trityloxymethyl)cyclopentyl]methanol (PubChem CID 101470588) has the molecular formula C32H42O3Si and a molecular weight of 502.77 g/mol. Its IUPAC name is [(1R,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(trityloxymethyl)cyclopentyl]methanol.
| Compound Name | [(1R,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(trityloxymethyl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 101470588 |
| Molecular Formula | C32H42O3Si |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | [(1R,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(trityloxymethyl)cyclopentyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](CO)[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C32H42O3Si/c1-31(2,3)36(4,5)35-30-21-25(23-33)26(22-30)24-34-32(27-15-9-6-10-16-27,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h6-20,25-26,30,33H,21-24H2,1-5H3/t25-,26-,30-/m0/s1 |
| InChIKey | DCLZNBAPYYGTBC-JCGRVDTESA-N |
| XLogP | 7.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|