C38H56O5Si2 — CID 11285204
(1S)-1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(trityloxymethyl)oxolan-2-yl]ethanol (PubChem CID 11285204) has the molecular formula C38H56O5Si2 and a molecular weight of 649.03 g/mol. Its IUPAC name is (1S)-1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(trityloxymethyl)oxolan-2-yl]ethanol.
| Compound Name | (1S)-1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(trityloxymethyl)oxolan-2-yl]ethanol |
|---|---|
| PubChem CID | 11285204 |
| Molecular Formula | C38H56O5Si2 |
| Molecular Weight | 649.03 g/mol |
| Exact Mass | 648.37 |
| IUPAC Name | (1S)-1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(trityloxymethyl)oxolan-2-yl]ethanol |
| SMILES | C[C@H](O)[C@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H56O5Si2/c1-28(39)33-35(43-45(10,11)37(5,6)7)34(42-44(8,9)36(2,3)4)32(41-33)27-40-38(29-21-15-12-16-22-29,30-23-17-13-18-24-30)31-25-19-14-20-26-31/h12-26,28,32-35,39H,27H2,1-11H3/t28-,32+,33+,34+,35+/m0/s1 |
| InChIKey | NZDQUQRUKKTYMA-RXFHZEGLSA-N |
| XLogP | 8.92 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.03 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|