C37H50NO7PSi — CID 175620903
3-[[(2S,3S,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-2-methyloxolan-3-yl]oxy-methylphosphanyl]oxypropanenitrile (PubChem CID 175620903) has the molecular formula C37H50NO7PSi and a molecular weight of 679.87 g/mol. Its IUPAC name is 3-[[(2S,3S,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-2-methyloxolan-3-yl]oxy-methylphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2S,3S,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-2-methyloxolan-3-yl]oxy-methylphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 175620903 |
| Molecular Formula | C37H50NO7PSi |
| Molecular Weight | 679.87 g/mol |
| Exact Mass | 679.31 |
| IUPAC Name | 3-[[(2S,3S,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-2-methyloxolan-3-yl]oxy-methylphosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](C)[C@H](OP(C)OCCC#N)[C@@H]2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H50NO7PSi/c1-27-34(44-46(7)42-25-13-24-38)35(45-47(8,9)36(2,3)4)33(43-27)26-41-37(28-14-11-10-12-15-28,29-16-20-31(39-5)21-17-29)30-18-22-32(40-6)23-19-30/h10-12,14-23,27,33-35H,13,25-26H2,1-9H3/t27-,33+,34-,35+,46?/m0/s1 |
| InChIKey | HAKFYUMDSSRGCZ-ODWZVEKQSA-N |
| XLogP | 8.45 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.87 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|