C43H58O5SeSi2 — CID 101051182
(2S,3R,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenylselanyl-6-(trityloxymethyl)oxan-3-ol (PubChem CID 101051182) has the molecular formula C43H58O5SeSi2 and a molecular weight of 790.06 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenylselanyl-6-(trityloxymethyl)oxan-3-ol.
| Compound Name | (2S,3R,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenylselanyl-6-(trityloxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 101051182 |
| Molecular Formula | C43H58O5SeSi2 |
| Molecular Weight | 790.06 g/mol |
| Exact Mass | 790.30 |
| IUPAC Name | (2S,3R,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenylselanyl-6-(trityloxymethyl)oxan-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H]([Se]c2ccccc2)O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C43H58O5SeSi2/c1-41(2,3)50(7,8)47-38-36(46-40(49-35-29-21-14-22-30-35)37(44)39(38)48-51(9,10)42(4,5)6)31-45-43(32-23-15-11-16-24-32,33-25-17-12-18-26-33)34-27-19-13-20-28-34/h11-30,36-40,44H,31H2,1-10H3/t36-,37-,38-,39-,40+/m1/s1 |
| InChIKey | CQRXNTIOFYVPSU-VTDZCKIGSA-N |
| XLogP | 8.89 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.06 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|