C48H54O7SSi — CID 11814755
[(2R,3S,4S,5R,6S)-5-benzoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-ylsulfanyl-2-(trityloxymethyl)oxan-3-yl] benzoate (PubChem CID 11814755) has the molecular formula C48H54O7SSi and a molecular weight of 803.11 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-5-benzoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-ylsulfanyl-2-(trityloxymethyl)oxan-3-yl] benzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-5-benzoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-ylsulfanyl-2-(trityloxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11814755 |
| Molecular Formula | C48H54O7SSi |
| Molecular Weight | 803.11 g/mol |
| Exact Mass | 802.34 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-5-benzoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-ylsulfanyl-2-(trityloxymethyl)oxan-3-yl] benzoate |
| SMILES | CC(C)S[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C48H54O7SSi/c1-34(2)56-46-43(54-45(50)36-25-15-9-16-26-36)42(55-57(6,7)47(3,4)5)41(53-44(49)35-23-13-8-14-24-35)40(52-46)33-51-48(37-27-17-10-18-28-37,38-29-19-11-20-30-38)39-31-21-12-22-32-39/h8-32,34,40-43,46H,33H2,1-7H3/t40-,41+,42+,43-,46+/m1/s1 |
| InChIKey | CWPFAFUZFUFRGP-VUUNKKEWSA-N |
| XLogP | 10.70 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.11 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|