C32H40O3Si — CID 46928266
(1R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3-(trityloxymethyl)cyclopentan-1-ol (PubChem CID 46928266) has the molecular formula C32H40O3Si and a molecular weight of 500.76 g/mol. Its IUPAC name is (1R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3-(trityloxymethyl)cyclopentan-1-ol.
| Compound Name | (1R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3-(trityloxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 46928266 |
| Molecular Formula | C32H40O3Si |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | (1R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3-(trityloxymethyl)cyclopentan-1-ol |
| SMILES | C=C1[C@H](O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H40O3Si/c1-24-28(30(22-29(24)33)35-36(5,6)31(2,3)4)23-34-32(25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21,28-30,33H,1,22-23H2,2-6H3/t28-,29+,30-/m0/s1 |
| InChIKey | HGFORZGBCGJSDS-JBOQNHBVSA-N |
| XLogP | 7.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|