C30H34O4Si — CID 56651565
[(1S,2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-3-methylidenecyclopentyl] benzoate (PubChem CID 56651565) has the molecular formula C30H34O4Si and a molecular weight of 486.68 g/mol. Its IUPAC name is [(1S,2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-3-methylidenecyclopentyl] benzoate.
| Compound Name | [(1S,2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-3-methylidenecyclopentyl] benzoate |
|---|---|
| PubChem CID | 56651565 |
| Molecular Formula | C30H34O4Si |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [(1S,2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-3-methylidenecyclopentyl] benzoate |
| SMILES | C=C1[C@H](O)C[C@H](OC(=O)c2ccccc2)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H34O4Si/c1-22-26(28(20-27(22)31)34-29(32)23-14-8-5-9-15-23)21-33-35(30(2,3)4,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,26-28,31H,1,20-21H2,2-4H3/t26-,27+,28-/m0/s1 |
| InChIKey | CFGAROWHGQIIAI-IARZGTGTSA-N |
| XLogP | 4.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|