C33H40O6Si — CID 175984773
[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-2,2-dimethyl-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-yl] benzoate (PubChem CID 175984773) has the molecular formula C33H40O6Si and a molecular weight of 560.76 g/mol. Its IUPAC name is [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-2,2-dimethyl-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-yl] benzoate.
| Compound Name | [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-2,2-dimethyl-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-yl] benzoate |
|---|---|
| PubChem CID | 175984773 |
| Molecular Formula | C33H40O6Si |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-2,2-dimethyl-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-yl] benzoate |
| SMILES | CC1(C)OC2CC(O)(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC(OC(=O)c3ccccc3)C2O1 |
| InChI | InChI=1S/C33H40O6Si/c1-31(2,3)40(25-17-11-7-12-18-25,26-19-13-8-14-20-26)36-23-33(35)21-27(29-28(22-33)38-32(4,5)39-29)37-30(34)24-15-9-6-10-16-24/h6-20,27-29,35H,21-23H2,1-5H3 |
| InChIKey | NSRFMORAXAZULK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|