C27H32F3NO5Si — CID 101251521
1-[(1R,2S,5S,7R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-9,9-dimethyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decan-3-yl]-2,2,2-trifluoroethanone (PubChem CID 101251521) has the molecular formula C27H32F3NO5Si and a molecular weight of 535.64 g/mol. Its IUPAC name is 1-[(1R,2S,5S,7R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-9,9-dimethyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decan-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(1R,2S,5S,7R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-9,9-dimethyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decan-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 101251521 |
| Molecular Formula | C27H32F3NO5Si |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 1-[(1R,2S,5S,7R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-9,9-dimethyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decan-3-yl]-2,2,2-trifluoroethanone |
| SMILES | CC1(C)O[C@H]2O[C@@]3(CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)CN(C(=O)C(F)(F)F)[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C27H32F3NO5Si/c1-24(2,3)37(18-12-8-6-9-13-18,19-14-10-7-11-15-19)33-17-26-16-31(23(32)27(28,29)30)21(26)20-22(36-26)35-25(4,5)34-20/h6-15,20-22H,16-17H2,1-5H3/t20-,21+,22+,26-/m1/s1 |
| InChIKey | DUBILGDUFXEMPQ-FYBXHKAZSA-N |
| XLogP | 3.58 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|