C25H32O6Si — CID 15343718
(3aS,6R,6aS)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxole-6-carboxylic acid (PubChem CID 15343718) has the molecular formula C25H32O6Si and a molecular weight of 456.61 g/mol. Its IUPAC name is (3aS,6R,6aS)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxole-6-carboxylic acid.
| Compound Name | (3aS,6R,6aS)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxole-6-carboxylic acid |
|---|---|
| PubChem CID | 15343718 |
| Molecular Formula | C25H32O6Si |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (3aS,6R,6aS)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxole-6-carboxylic acid |
| SMILES | CC1(C)O[C@H]2[C@H](C(=O)O)OC[C@@]2(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H32O6Si/c1-23(2,3)32(18-12-8-6-9-13-18,19-14-10-7-11-15-19)29-17-25-16-28-20(22(26)27)21(25)30-24(4,5)31-25/h6-15,20-21H,16-17H2,1-5H3,(H,26,27)/t20-,21+,25+/m1/s1 |
| InChIKey | YWJYZKFITFOQJD-CZSZKKDXSA-N |
| XLogP | 2.94 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|