C25H33IO4SSi — CID 153401748
[(3aS,4R,5R,6aR)-4-(iodomethyl)-2,2-dimethyl-5-oxo-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 153401748) has the molecular formula C25H33IO4SSi and a molecular weight of 584.59 g/mol. Its IUPAC name is [(3aS,4R,5R,6aR)-4-(iodomethyl)-2,2-dimethyl-5-oxo-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,4R,5R,6aR)-4-(iodomethyl)-2,2-dimethyl-5-oxo-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 153401748 |
| Molecular Formula | C25H33IO4SSi |
| Molecular Weight | 584.59 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | [(3aS,4R,5R,6aR)-4-(iodomethyl)-2,2-dimethyl-5-oxo-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@H]2C[S@@](=O)[C@](CI)(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C25H33IO4SSi/c1-23(2,3)32(19-12-8-6-9-13-19,20-14-10-7-11-15-20)28-18-25(17-26)22-21(16-31(25)27)29-24(4,5)30-22/h6-15,21-22H,16-18H2,1-5H3/t21-,22-,25+,31+/m0/s1 |
| InChIKey | LTMLXFKTFPPYOJ-GCVTWIBZSA-N |
| XLogP | 4.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|