C26H34O5Si — CID 59751308
(3aR,5S,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde (PubChem CID 59751308) has the molecular formula C26H34O5Si and a molecular weight of 454.64 g/mol. Its IUPAC name is (3aR,5S,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde.
| Compound Name | (3aR,5S,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 59751308 |
| Molecular Formula | C26H34O5Si |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | (3aR,5S,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde |
| SMILES | C[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@]1(C=O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H34O5Si/c1-19-22-23(30-25(5,6)29-22)31-26(19,17-27)18-28-32(24(2,3)4,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-17,19,22-23H,18H2,1-6H3/t19-,22+,23-,26+/m0/s1 |
| InChIKey | AKSPGJSNRMBMHL-ASTYLPHCSA-N |
| XLogP | 3.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|