C36H42O5Si — CID 140673781
[(3aR,5R,6S,6aR)-2,2,5-trimethyl-6-(naphthalen-2-ylmethoxy)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 140673781) has the molecular formula C36H42O5Si and a molecular weight of 582.81 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-2,2,5-trimethyl-6-(naphthalen-2-ylmethoxy)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,5R,6S,6aR)-2,2,5-trimethyl-6-(naphthalen-2-ylmethoxy)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 140673781 |
| Molecular Formula | C36H42O5Si |
| Molecular Weight | 582.81 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | [(3aR,5R,6S,6aR)-2,2,5-trimethyl-6-(naphthalen-2-ylmethoxy)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@H]2O[C@](C)(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](OCc3ccc4ccccc4c3)[C@H]2O1 |
| InChI | InChI=1S/C36H42O5Si/c1-34(2,3)42(29-17-9-7-10-18-29,30-19-11-8-12-20-30)38-25-36(6)32(31-33(41-36)40-35(4,5)39-31)37-24-26-21-22-27-15-13-14-16-28(27)23-26/h7-23,31-33H,24-25H2,1-6H3/t31-,32+,33+,36-/m1/s1 |
| InChIKey | CFRWBYGOAJPYSQ-ORAXTSPASA-N |
| XLogP | 6.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.81 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|