C22H36O6Si — CID 102183815
[(3aR,6R,6aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol (PubChem CID 102183815) has the molecular formula C22H36O6Si and a molecular weight of 424.61 g/mol. Its IUPAC name is [(3aR,6R,6aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol.
| Compound Name | [(3aR,6R,6aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol |
|---|---|
| PubChem CID | 102183815 |
| Molecular Formula | C22H36O6Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | [(3aR,6R,6aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol |
| SMILES | CC1(C)O[C@H]2OC(CO)(CO[Si](C)(C)C(C)(C)C)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C22H36O6Si/c1-20(2,3)29(6,7)25-15-22(14-23)18(24-13-16-11-9-8-10-12-16)17-19(28-22)27-21(4,5)26-17/h8-12,17-19,23H,13-15H2,1-7H3/t17-,18-,19+,22?/m1/s1 |
| InChIKey | VHMUBQGPHPIZSI-AGQFNQOXSA-N |
| XLogP | 3.83 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|