C27H34O7 — CID 135235540
ethyl 3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]propanoate (PubChem CID 135235540) has the molecular formula C27H34O7 and a molecular weight of 470.56 g/mol. Its IUPAC name is ethyl 3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]propanoate.
| Compound Name | ethyl 3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]propanoate |
|---|---|
| PubChem CID | 135235540 |
| Molecular Formula | C27H34O7 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | ethyl 3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]propanoate |
| SMILES | CCOC(=O)CC[C@]1(COCc2ccccc2)O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H34O7/c1-4-30-22(28)15-16-27(19-29-17-20-11-7-5-8-12-20)24(31-18-21-13-9-6-10-14-21)23-25(34-27)33-26(2,3)32-23/h5-14,23-25H,4,15-19H2,1-3H3/t23-,24+,25+,27-/m1/s1 |
| InChIKey | ORZPAMILJOZLTE-DPRQWMOBSA-N |
| XLogP | 4.38 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |