C26H34O7 — CID 71190309
(3aR,5R,6R)-5-ethyl-6-[(4-methoxyphenyl)methoxy]-5-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole (PubChem CID 71190309) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is (3aR,5R,6R)-5-ethyl-6-[(4-methoxyphenyl)methoxy]-5-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6R)-5-ethyl-6-[(4-methoxyphenyl)methoxy]-5-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 71190309 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (3aR,5R,6R)-5-ethyl-6-[(4-methoxyphenyl)methoxy]-5-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
| SMILES | CC[C@]1(COCc2ccc(OC)cc2)O[C@@H]2OC(C)(C)OC2[C@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H34O7/c1-6-26(17-29-15-18-7-11-20(27-4)12-8-18)23(22-24(33-26)32-25(2,3)31-22)30-16-19-9-13-21(28-5)14-10-19/h7-14,22-24H,6,15-17H2,1-5H3/t22?,23-,24+,26-/m1/s1 |
| InChIKey | FRAACOYVTJLDTE-SWIDVAJJSA-N |
| XLogP | 4.46 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |