C17H24O6 — CID 70790141
[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol (PubChem CID 70790141) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol.
| Compound Name | [(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol |
|---|---|
| PubChem CID | 70790141 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol |
| SMILES | CO[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@]1(CO)COCc1ccccc1 |
| InChI | InChI=1S/C17H24O6/c1-16(2)21-13-14(19-3)17(10-18,23-15(13)22-16)11-20-9-12-7-5-4-6-8-12/h4-8,13-15,18H,9-11H2,1-3H3/t13-,14+,15+,17-/m1/s1 |
| InChIKey | XHEBEJLGMHJZLY-WBTNSWJXSA-N |
| XLogP | 1.46 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |