C24H30O6 — CID 174093486
(1S)-1-[(3aS,5S)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethanol (PubChem CID 174093486) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (1S)-1-[(3aS,5S)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethanol.
| Compound Name | (1S)-1-[(3aS,5S)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethanol |
|---|---|
| PubChem CID | 174093486 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (1S)-1-[(3aS,5S)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethanol |
| SMILES | C[C@H](O)[C@]1(COCc2ccccc2)O[C@H]2OC(C)(C)OC2C1OCc1ccccc1 |
| InChI | InChI=1S/C24H30O6/c1-17(25)24(16-26-14-18-10-6-4-7-11-18)21(27-15-19-12-8-5-9-13-19)20-22(30-24)29-23(2,3)28-20/h4-13,17,20-22,25H,14-16H2,1-3H3/t17-,20?,21?,22+,24-/m0/s1 |
| InChIKey | FQZWNECQQOGFKG-PKTMBPDJSA-N |
| XLogP | 3.42 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |