C32H40O6Si — CID 173065798
[5-(1-diphenylsilyloxy-2,2-dimethylpropyl)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol (PubChem CID 173065798) has the molecular formula C32H40O6Si and a molecular weight of 548.75 g/mol. Its IUPAC name is [5-(1-diphenylsilyloxy-2,2-dimethylpropyl)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol.
| Compound Name | [5-(1-diphenylsilyloxy-2,2-dimethylpropyl)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol |
|---|---|
| PubChem CID | 173065798 |
| Molecular Formula | C32H40O6Si |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | [5-(1-diphenylsilyloxy-2,2-dimethylpropyl)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol |
| SMILES | CC1(C)OC2OC(CO)(C(O[SiH](c3ccccc3)c3ccccc3)C(C)(C)C)C(OCc3ccccc3)C2O1 |
| InChI | InChI=1S/C32H40O6Si/c1-30(2,3)29(38-39(24-17-11-7-12-18-24)25-19-13-8-14-20-25)32(22-33)27(34-21-23-15-9-6-10-16-23)26-28(37-32)36-31(4,5)35-26/h6-20,26-29,33,39H,21-22H2,1-5H3 |
| InChIKey | KWYUOYYPHIWRSW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|