C17H22O5 — CID 164935094
(1'R,5R,6aS)-2,2-dimethyl-6-phenylmethoxyspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,2'-cyclobutane]-1'-ol (PubChem CID 164935094) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (1'R,5R,6aS)-2,2-dimethyl-6-phenylmethoxyspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,2'-cyclobutane]-1'-ol.
| Compound Name | (1'R,5R,6aS)-2,2-dimethyl-6-phenylmethoxyspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,2'-cyclobutane]-1'-ol |
|---|---|
| PubChem CID | 164935094 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (1'R,5R,6aS)-2,2-dimethyl-6-phenylmethoxyspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,2'-cyclobutane]-1'-ol |
| SMILES | CC1(C)OC2O[C@@]3(CC[C@H]3O)C(OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C17H22O5/c1-16(2)20-13-14(19-10-11-6-4-3-5-7-11)17(9-8-12(17)18)22-15(13)21-16/h3-7,12-15,18H,8-10H2,1-2H3/t12-,13+,14?,15?,17-/m1/s1 |
| InChIKey | ZWVGRQJBHBMBGJ-SALKPKHPSA-N |
| XLogP | 1.97 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |