C25H28O7 — CID 135235559
(E)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]prop-2-enoic acid (PubChem CID 135235559) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is (E)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135235559 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (E)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]prop-2-enoic acid |
| SMILES | CC1(C)O[C@H]2O[C@](/C=C/C(=O)O)(COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C25H28O7/c1-24(2)30-21-22(29-16-19-11-7-4-8-12-19)25(14-13-20(26)27,32-23(21)31-24)17-28-15-18-9-5-3-6-10-18/h3-14,21-23H,15-17H2,1-2H3,(H,26,27)/b14-13+/t21-,22+,23+,25-/m1/s1 |
| InChIKey | JGKPJHQWMZFNNB-HZIWTLLRSA-N |
| XLogP | 3.68 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|