C26H30Cl2O5Si — CID 167678407
(3aR,5R,6aS)-6-[tert-butyl(diphenyl)silyl]oxy-2',2'-dichloro-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,3'-cyclobutane]-1'-one (PubChem CID 167678407) has the molecular formula C26H30Cl2O5Si and a molecular weight of 521.51 g/mol. Its IUPAC name is (3aR,5R,6aS)-6-[tert-butyl(diphenyl)silyl]oxy-2',2'-dichloro-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,3'-cyclobutane]-1'-one.
| Compound Name | (3aR,5R,6aS)-6-[tert-butyl(diphenyl)silyl]oxy-2',2'-dichloro-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,3'-cyclobutane]-1'-one |
|---|---|
| PubChem CID | 167678407 |
| Molecular Formula | C26H30Cl2O5Si |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | (3aR,5R,6aS)-6-[tert-butyl(diphenyl)silyl]oxy-2',2'-dichloro-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,3'-cyclobutane]-1'-one |
| SMILES | CC1(C)O[C@H]2O[C@]3(CC(=O)C3(Cl)Cl)C(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C26H30Cl2O5Si/c1-23(2,3)34(17-12-8-6-9-13-17,18-14-10-7-11-15-18)33-21-20-22(31-24(4,5)30-20)32-25(21)16-19(29)26(25,27)28/h6-15,20-22H,16H2,1-5H3/t20-,21?,22-,25+/m0/s1 |
| InChIKey | MYHOCNSXVVRAGE-GAOPWCJCSA-N |
| XLogP | 4.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|