C31H34Cl2O5Si — CID 164935263
(4S,8R)-7-[tert-butyl(diphenyl)silyl]oxy-3,3-dichloro-6-methoxy-8-phenylmethoxy-5-oxaspiro[3.4]octan-2-one (PubChem CID 164935263) has the molecular formula C31H34Cl2O5Si and a molecular weight of 585.60 g/mol. Its IUPAC name is (4S,8R)-7-[tert-butyl(diphenyl)silyl]oxy-3,3-dichloro-6-methoxy-8-phenylmethoxy-5-oxaspiro[3.4]octan-2-one.
| Compound Name | (4S,8R)-7-[tert-butyl(diphenyl)silyl]oxy-3,3-dichloro-6-methoxy-8-phenylmethoxy-5-oxaspiro[3.4]octan-2-one |
|---|---|
| PubChem CID | 164935263 |
| Molecular Formula | C31H34Cl2O5Si |
| Molecular Weight | 585.60 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | (4S,8R)-7-[tert-butyl(diphenyl)silyl]oxy-3,3-dichloro-6-methoxy-8-phenylmethoxy-5-oxaspiro[3.4]octan-2-one |
| SMILES | COC1O[C@@]2(CC(=O)C2(Cl)Cl)[C@H](OCc2ccccc2)C1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H34Cl2O5Si/c1-29(2,3)39(23-16-10-6-11-17-23,24-18-12-7-13-19-24)38-26-27(36-21-22-14-8-5-9-15-22)30(37-28(26)35-4)20-25(34)31(30,32)33/h5-19,26-28H,20-21H2,1-4H3/t26?,27-,28?,30+/m1/s1 |
| InChIKey | JFVVOSLAQIAJSH-LXCSTLNQSA-N |
| XLogP | 5.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|