C30H34O3Si — CID 59638511
tert-butyl-diphenyl-[[(1S,4R,7R)-7-phenylmethoxy-2-oxabicyclo[2.2.1]hept-5-en-1-yl]methoxy]silane (PubChem CID 59638511) has the molecular formula C30H34O3Si and a molecular weight of 470.69 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(1S,4R,7R)-7-phenylmethoxy-2-oxabicyclo[2.2.1]hept-5-en-1-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(1S,4R,7R)-7-phenylmethoxy-2-oxabicyclo[2.2.1]hept-5-en-1-yl]methoxy]silane |
|---|---|
| PubChem CID | 59638511 |
| Molecular Formula | C30H34O3Si |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | tert-butyl-diphenyl-[[(1S,4R,7R)-7-phenylmethoxy-2-oxabicyclo[2.2.1]hept-5-en-1-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](OC[C@]12C=C[C@H](CO1)[C@H]2OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H34O3Si/c1-29(2,3)34(26-15-9-5-10-16-26,27-17-11-6-12-18-27)33-23-30-20-19-25(22-32-30)28(30)31-21-24-13-7-4-8-14-24/h4-20,25,28H,21-23H2,1-3H3/t25-,28-,30+/m1/s1 |
| InChIKey | ZNGDRZZGSWKAQN-CZMKHNCBSA-N |
| XLogP | 5.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|