C25H32O4Si — CID 102574885
tert-butyl-[[(8R,9R)-8-methoxy-1,4-dioxaspiro[4.4]non-6-en-9-yl]methoxy]-diphenylsilane (PubChem CID 102574885) has the molecular formula C25H32O4Si and a molecular weight of 424.61 g/mol. Its IUPAC name is tert-butyl-[[(8R,9R)-8-methoxy-1,4-dioxaspiro[4.4]non-6-en-9-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(8R,9R)-8-methoxy-1,4-dioxaspiro[4.4]non-6-en-9-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 102574885 |
| Molecular Formula | C25H32O4Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | tert-butyl-[[(8R,9R)-8-methoxy-1,4-dioxaspiro[4.4]non-6-en-9-yl]methoxy]-diphenylsilane |
| SMILES | CO[C@@H]1C=CC2(OCCO2)[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H32O4Si/c1-24(2,3)30(20-11-7-5-8-12-20,21-13-9-6-10-14-21)29-19-22-23(26-4)15-16-25(22)27-17-18-28-25/h5-16,22-23H,17-19H2,1-4H3/t22-,23-/m1/s1 |
| InChIKey | WITNJTWJDJTHOY-DHIUTWEWSA-N |
| XLogP | 3.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|