C40H52O4Si2 — CID 158489976
tert-butyl-[[(1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-dimethoxycyclobutyl]methoxy]-diphenylsilane (PubChem CID 158489976) has the molecular formula C40H52O4Si2 and a molecular weight of 653.02 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-dimethoxycyclobutyl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-dimethoxycyclobutyl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 158489976 |
| Molecular Formula | C40H52O4Si2 |
| Molecular Weight | 653.02 g/mol |
| Exact Mass | 652.34 |
| IUPAC Name | tert-butyl-[[(1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-dimethoxycyclobutyl]methoxy]-diphenylsilane |
| SMILES | COC1(OC)C[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C40H52O4Si2/c1-38(2,3)45(33-21-13-9-14-22-33,34-23-15-10-16-24-34)43-30-32-29-40(41-7,42-8)37(32)31-44-46(39(4,5)6,35-25-17-11-18-26-35)36-27-19-12-20-28-36/h9-28,32,37H,29-31H2,1-8H3/t32-,37-/m1/s1 |
| InChIKey | HIOPQANIAPDOKJ-WECIHKQLSA-N |
| XLogP | 6.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.02 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|