C29H44O4Si2 — CID 174024292
tert-butyl-[[(1S,2S)-2-(1-tert-butylsilyloxyethenyl)-3,3-dimethoxycyclobutyl]methoxy]-diphenylsilane (PubChem CID 174024292) has the molecular formula C29H44O4Si2 and a molecular weight of 512.84 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S)-2-(1-tert-butylsilyloxyethenyl)-3,3-dimethoxycyclobutyl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1S,2S)-2-(1-tert-butylsilyloxyethenyl)-3,3-dimethoxycyclobutyl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 174024292 |
| Molecular Formula | C29H44O4Si2 |
| Molecular Weight | 512.84 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | tert-butyl-[[(1S,2S)-2-(1-tert-butylsilyloxyethenyl)-3,3-dimethoxycyclobutyl]methoxy]-diphenylsilane |
| SMILES | C=C(O[SiH2]C(C)(C)C)[C@@H]1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1(OC)OC |
| InChI | InChI=1S/C29H44O4Si2/c1-22(33-34-27(2,3)4)26-23(20-29(26,30-8)31-9)21-32-35(28(5,6)7,24-16-12-10-13-17-24)25-18-14-11-15-19-25/h10-19,23,26H,1,20-21,34H2,2-9H3/t23-,26-/m1/s1 |
| InChIKey | ABPQVAKSSPIXJE-ZEQKJWHPSA-N |
| XLogP | 5.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|