C25H32O3Si — CID 603410
tert-butyl-[(2,6-dimethoxycyclohexa-2,5-dien-1-yl)methoxy]-diphenylsilane (PubChem CID 603410) has the molecular formula C25H32O3Si and a molecular weight of 408.61 g/mol. Its IUPAC name is tert-butyl-[(2,6-dimethoxycyclohexa-2,5-dien-1-yl)methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2,6-dimethoxycyclohexa-2,5-dien-1-yl)methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 603410 |
| Molecular Formula | C25H32O3Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | tert-butyl-[(2,6-dimethoxycyclohexa-2,5-dien-1-yl)methoxy]-diphenylsilane |
| SMILES | COC1=CCC=C(OC)C1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H32O3Si/c1-25(2,3)29(20-13-8-6-9-14-20,21-15-10-7-11-16-21)28-19-22-23(26-4)17-12-18-24(22)27-5/h6-11,13-18,22H,12,19H2,1-5H3 |
| InChIKey | TZYYEVVKTVPDJA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|