C21H26F2O2Si — CID 58682742
[(1R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-difluorocyclopropyl]methanol (PubChem CID 58682742) has the molecular formula C21H26F2O2Si and a molecular weight of 376.52 g/mol. Its IUPAC name is [(1R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-difluorocyclopropyl]methanol.
| Compound Name | [(1R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-difluorocyclopropyl]methanol |
|---|---|
| PubChem CID | 58682742 |
| Molecular Formula | C21H26F2O2Si |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [(1R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-difluorocyclopropyl]methanol |
| SMILES | CC(C)(C)[Si](OC[C@H]1[C@H](CO)C1(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26F2O2Si/c1-20(2,3)26(16-10-6-4-7-11-16,17-12-8-5-9-13-17)25-15-19-18(14-24)21(19,22)23/h4-13,18-19,24H,14-15H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | CMQPTIALJGHENU-OALUTQOASA-N |
| XLogP | 3.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|