C26H38O2Si — CID 15443826
[(1R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,2-trimethylcyclopentyl]methanol (PubChem CID 15443826) has the molecular formula C26H38O2Si and a molecular weight of 410.67 g/mol. Its IUPAC name is [(1R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,2-trimethylcyclopentyl]methanol.
| Compound Name | [(1R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,2-trimethylcyclopentyl]methanol |
|---|---|
| PubChem CID | 15443826 |
| Molecular Formula | C26H38O2Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | [(1R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,2-trimethylcyclopentyl]methanol |
| SMILES | CC1(C)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@@]1(C)CO |
| InChI | InChI=1S/C26H38O2Si/c1-24(2,3)29(22-13-9-7-10-14-22,23-15-11-8-12-16-23)28-19-21-17-18-26(6,20-27)25(21,4)5/h7-16,21,27H,17-20H2,1-6H3/t21-,26+/m1/s1 |
| InChIKey | XNDVDQNCQNGUSK-RLWLMLJZSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|