C49H70OSi2 — CID 68580534
tert-butyl-[[3-[5-[tert-butyl(diphenyl)silyl]-6-methylheptan-2-yl]-2,2,3-trimethylcyclopentyl]methoxy]-diphenylsilane (PubChem CID 68580534) has the molecular formula C49H70OSi2 and a molecular weight of 731.27 g/mol. Its IUPAC name is tert-butyl-[[3-[5-[tert-butyl(diphenyl)silyl]-6-methylheptan-2-yl]-2,2,3-trimethylcyclopentyl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[3-[5-[tert-butyl(diphenyl)silyl]-6-methylheptan-2-yl]-2,2,3-trimethylcyclopentyl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 68580534 |
| Molecular Formula | C49H70OSi2 |
| Molecular Weight | 731.27 g/mol |
| Exact Mass | 730.50 |
| IUPAC Name | tert-butyl-[[3-[5-[tert-butyl(diphenyl)silyl]-6-methylheptan-2-yl]-2,2,3-trimethylcyclopentyl]methoxy]-diphenylsilane |
| SMILES | CC(C)C(CCC(C)C1(C)CCC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1(C)C)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C49H70OSi2/c1-38(2)45(51(46(4,5)6,41-25-17-13-18-26-41)42-27-19-14-20-28-42)34-33-39(3)49(12)36-35-40(48(49,10)11)37-50-52(47(7,8)9,43-29-21-15-22-30-43)44-31-23-16-24-32-44/h13-32,38-40,45H,33-37H2,1-12H3 |
| InChIKey | XWYPIAXRFPTQIU-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.27 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|