C33H52O2Si — CID 88877030
[(1R,3R)-3-[(2S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-6-methylheptan-2-yl]-2,2,3-trimethylcyclopentyl]methanol (PubChem CID 88877030) has the molecular formula C33H52O2Si and a molecular weight of 508.86 g/mol. Its IUPAC name is [(1R,3R)-3-[(2S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-6-methylheptan-2-yl]-2,2,3-trimethylcyclopentyl]methanol.
| Compound Name | [(1R,3R)-3-[(2S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-6-methylheptan-2-yl]-2,2,3-trimethylcyclopentyl]methanol |
|---|---|
| PubChem CID | 88877030 |
| Molecular Formula | C33H52O2Si |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 508.37 |
| IUPAC Name | [(1R,3R)-3-[(2S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-6-methylheptan-2-yl]-2,2,3-trimethylcyclopentyl]methanol |
| SMILES | CC(C)[C@H](CC[C@H](C)[C@@]1(C)CC[C@@H](CO)C1(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H52O2Si/c1-25(2)30(21-20-26(3)33(9)23-22-27(24-34)32(33,7)8)35-36(31(4,5)6,28-16-12-10-13-17-28)29-18-14-11-15-19-29/h10-19,25-27,30,34H,20-24H2,1-9H3/t26-,27-,30-,33+/m0/s1 |
| InChIKey | XJLUOPKQYXQALG-AXKMEIGOSA-N |
| XLogP | 7.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|