C33H52O2Si — CID 173095127
(3S,6S)-6-[(1R,3R)-3-(1-diphenylsilyloxy-2,2-dimethylpropyl)-1,2,2-trimethylcyclopentyl]-2-methylheptan-3-ol (PubChem CID 173095127) has the molecular formula C33H52O2Si and a molecular weight of 508.86 g/mol. Its IUPAC name is (3S,6S)-6-[(1R,3R)-3-(1-diphenylsilyloxy-2,2-dimethylpropyl)-1,2,2-trimethylcyclopentyl]-2-methylheptan-3-ol.
| Compound Name | (3S,6S)-6-[(1R,3R)-3-(1-diphenylsilyloxy-2,2-dimethylpropyl)-1,2,2-trimethylcyclopentyl]-2-methylheptan-3-ol |
|---|---|
| PubChem CID | 173095127 |
| Molecular Formula | C33H52O2Si |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 508.37 |
| IUPAC Name | (3S,6S)-6-[(1R,3R)-3-(1-diphenylsilyloxy-2,2-dimethylpropyl)-1,2,2-trimethylcyclopentyl]-2-methylheptan-3-ol |
| SMILES | CC(C)[C@@H](O)CC[C@H](C)[C@@]1(C)CC[C@@H](C(O[SiH](c2ccccc2)c2ccccc2)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C33H52O2Si/c1-24(2)29(34)21-20-25(3)33(9)23-22-28(32(33,7)8)30(31(4,5)6)35-36(26-16-12-10-13-17-26)27-18-14-11-15-19-27/h10-19,24-25,28-30,34,36H,20-23H2,1-9H3/t25-,28-,29-,30?,33+/m0/s1 |
| InChIKey | NSTMQGOAXLAYKC-UZOGZUBASA-N |
| XLogP | 6.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|