C28H36OSi — CID 90681900
[(2R,3R,3aS,4R,6aR)-4-methyl-3-prop-2-enyl-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 90681900) has the molecular formula C28H36OSi and a molecular weight of 416.68 g/mol. Its IUPAC name is [(2R,3R,3aS,4R,6aR)-4-methyl-3-prop-2-enyl-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(2R,3R,3aS,4R,6aR)-4-methyl-3-prop-2-enyl-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 90681900 |
| Molecular Formula | C28H36OSi |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | [(2R,3R,3aS,4R,6aR)-4-methyl-3-prop-2-enyl-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | C=CC[C@@H]1[C@H]2[C@H](C)C=C[C@H]2C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H36OSi/c1-6-13-25-26(20-22-19-18-21(2)27(22)25)29-30(28(3,4)5,23-14-9-7-10-15-23)24-16-11-8-12-17-24/h6-12,14-19,21-22,25-27H,1,13,20H2,2-5H3/t21-,22+,25+,26-,27+/m1/s1 |
| InChIKey | UZJXFOXHHAQIRU-JQORZIESSA-N |
| XLogP | 5.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|