C30H40O2Si — CID 90681897
(1S,3aR,5R,6R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-6-methyl-1-(3-methylbut-2-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 90681897) has the molecular formula C30H40O2Si and a molecular weight of 460.73 g/mol. Its IUPAC name is (1S,3aR,5R,6R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-6-methyl-1-(3-methylbut-2-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (1S,3aR,5R,6R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-6-methyl-1-(3-methylbut-2-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 90681897 |
| Molecular Formula | C30H40O2Si |
| Molecular Weight | 460.73 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | (1S,3aR,5R,6R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-6-methyl-1-(3-methylbut-2-enyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | CC(C)=CC[C@@H]1C(=O)C[C@H]2C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](C)[C@H]21 |
| InChI | InChI=1S/C30H40O2Si/c1-21(2)17-18-26-27(31)19-23-20-28(22(3)29(23)26)32-33(30(4,5)6,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-17,22-23,26,28-29H,18-20H2,1-6H3/t22-,23-,26+,28+,29+/m0/s1 |
| InChIKey | CRWAMQHMIMERHN-RUOPXRBDSA-N |
| XLogP | 6.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.73 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|