C31H33NO3Si — CID 58951233
2-[(1R,2S,4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-bicyclo[2.2.1]heptanyl]isoindole-1,3-dione (PubChem CID 58951233) has the molecular formula C31H33NO3Si and a molecular weight of 495.70 g/mol. Its IUPAC name is 2-[(1R,2S,4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-bicyclo[2.2.1]heptanyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,2S,4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-bicyclo[2.2.1]heptanyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58951233 |
| Molecular Formula | C31H33NO3Si |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 2-[(1R,2S,4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-bicyclo[2.2.1]heptanyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)[Si](O[C@H]1C[C@H]2C[C@@H]1C[C@@H]2N1C(=O)c2ccccc2C1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H33NO3Si/c1-31(2,3)36(23-12-6-4-7-13-23,24-14-8-5-9-15-24)35-28-20-21-18-22(28)19-27(21)32-29(33)25-16-10-11-17-26(25)30(32)34/h4-17,21-22,27-28H,18-20H2,1-3H3/t21-,22-,27+,28+/m1/s1 |
| InChIKey | JNHOCKUUIWGXGU-BIQRORRISA-N |
| XLogP | 5.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|