C37H38N2O5Si — CID 142544416
benzyl N-[2-[tert-butyl(diphenyl)silyl]oxy-4-(1,3-dioxoisoindol-2-yl)cyclopentyl]carbamate (PubChem CID 142544416) has the molecular formula C37H38N2O5Si and a molecular weight of 618.81 g/mol. Its IUPAC name is benzyl N-[2-[tert-butyl(diphenyl)silyl]oxy-4-(1,3-dioxoisoindol-2-yl)cyclopentyl]carbamate.
| Compound Name | benzyl N-[2-[tert-butyl(diphenyl)silyl]oxy-4-(1,3-dioxoisoindol-2-yl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 142544416 |
| Molecular Formula | C37H38N2O5Si |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | benzyl N-[2-[tert-butyl(diphenyl)silyl]oxy-4-(1,3-dioxoisoindol-2-yl)cyclopentyl]carbamate |
| SMILES | CC(C)(C)[Si](OC1CC(N2C(=O)c3ccccc3C2=O)CC1NC(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H38N2O5Si/c1-37(2,3)45(28-17-9-5-10-18-28,29-19-11-6-12-20-29)44-33-24-27(39-34(40)30-21-13-14-22-31(30)35(39)41)23-32(33)38-36(42)43-25-26-15-7-4-8-16-26/h4-22,27,32-33H,23-25H2,1-3H3,(H,38,42) |
| InChIKey | WKVKXBPVTNBYJT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|