C20H29NO3Si — CID 42637666
2-[(1R,2R)-2-tri(propan-2-yl)silyloxycyclopropyl]isoindole-1,3-dione (PubChem CID 42637666) has the molecular formula C20H29NO3Si and a molecular weight of 359.54 g/mol. Its IUPAC name is 2-[(1R,2R)-2-tri(propan-2-yl)silyloxycyclopropyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,2R)-2-tri(propan-2-yl)silyloxycyclopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42637666 |
| Molecular Formula | C20H29NO3Si |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 2-[(1R,2R)-2-tri(propan-2-yl)silyloxycyclopropyl]isoindole-1,3-dione |
| SMILES | CC(C)[Si](O[C@@H]1C[C@H]1N1C(=O)c2ccccc2C1=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H29NO3Si/c1-12(2)25(13(3)4,14(5)6)24-18-11-17(18)21-19(22)15-9-7-8-10-16(15)20(21)23/h7-10,12-14,17-18H,11H2,1-6H3/t17-,18-/m1/s1 |
| InChIKey | UKYWYRSJBNOMAR-QZTJIDSGSA-N |
| XLogP | 4.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|