About azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione
azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione (PubChem CID 138706686) has the molecular formula C13H16N2O3
and a molecular weight of 248.28 g/mol. Its IUPAC name is azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione |
| PubChem CID | 138706686 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione |
| SMILES | COC1CC(N2C(=O)c3ccccc3C2=O)C1.N |
| InChI | InChI=1S/C13H13NO3.H3N/c1-17-9-6-8(7-9)14-12(15)10-4-2-3-5-11(10)13(14)16;/h2-5,8-9H,6-7H2,1H3;1H3 |
| InChIKey | OLZDTLWMWXZZCL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione?
The IUPAC name of azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione (CID 138706686) is azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione.
What is the SMILES notation for azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione?
The canonical SMILES for azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione is COC1CC(N2C(=O)c3ccccc3C2=O)C1.N.
What is the InChIKey of azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione?
The InChIKey is OLZDTLWMWXZZCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3.H3N/c1-17-9-6-8(7-9)14-12(15)10-4-2-3-5-11(10)13(14)16;/h2-5,8-9H,6-7H2,1H3;1H3.
What are the key properties of azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione?
azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione has a molecular weight of 248.28 g/mol, XLogP of 1.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-(3-methoxycyclobutyl)isoindole-1,3-dione is sourced from PubChem (CID 138706686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).