C17H19NO4 — CID 71304764
tert-butyl 3-(1,3-dioxoisoindol-2-yl)cyclobutane-1-carboxylate (PubChem CID 71304764) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is tert-butyl 3-(1,3-dioxoisoindol-2-yl)cyclobutane-1-carboxylate.
| Compound Name | tert-butyl 3-(1,3-dioxoisoindol-2-yl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 71304764 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | tert-butyl 3-(1,3-dioxoisoindol-2-yl)cyclobutane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC(N2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C17H19NO4/c1-17(2,3)22-16(21)10-8-11(9-10)18-14(19)12-6-4-5-7-13(12)15(18)20/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | MPCZSXHOGBETJP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|