C24H31NO5 — CID 73230613
tert-butyl 4-[2-(1,3-dioxoisoindol-2-yl)pent-4-enoxy]cyclohexane-1-carboxylate (PubChem CID 73230613) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is tert-butyl 4-[2-(1,3-dioxoisoindol-2-yl)pent-4-enoxy]cyclohexane-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(1,3-dioxoisoindol-2-yl)pent-4-enoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 73230613 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | tert-butyl 4-[2-(1,3-dioxoisoindol-2-yl)pent-4-enoxy]cyclohexane-1-carboxylate |
| SMILES | C=CCC(COC1CCC(C(=O)OC(C)(C)C)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H31NO5/c1-5-8-17(25-21(26)19-9-6-7-10-20(19)22(25)27)15-29-18-13-11-16(12-14-18)23(28)30-24(2,3)4/h5-7,9-10,16-18H,1,8,11-15H2,2-4H3 |
| InChIKey | PGNXZOZREDKIFZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|