C21H19NO5 — CID 22294512
[(2R,3R)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxyhex-5-enyl] benzoate (PubChem CID 22294512) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is [(2R,3R)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxyhex-5-enyl] benzoate.
| Compound Name | [(2R,3R)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxyhex-5-enyl] benzoate |
|---|---|
| PubChem CID | 22294512 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | [(2R,3R)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxyhex-5-enyl] benzoate |
| SMILES | C=CC[C@H]([C@@H](O)COC(=O)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H19NO5/c1-2-8-17(18(23)13-27-21(26)14-9-4-3-5-10-14)22-19(24)15-11-6-7-12-16(15)20(22)25/h2-7,9-12,17-18,23H,1,8,13H2/t17-,18+/m1/s1 |
| InChIKey | DXPNWCBHUMVWBK-MSOLQXFVSA-N |
| XLogP | 2.45 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|