C21H23BrO4 — CID 18652116
[(2R)-2-[(1S)-2-[(4-bromophenyl)methoxy]-1-hydroxyethyl]pent-4-enyl] benzoate (PubChem CID 18652116) has the molecular formula C21H23BrO4 and a molecular weight of 419.32 g/mol. Its IUPAC name is [(2R)-2-[(1S)-2-[(4-bromophenyl)methoxy]-1-hydroxyethyl]pent-4-enyl] benzoate.
| Compound Name | [(2R)-2-[(1S)-2-[(4-bromophenyl)methoxy]-1-hydroxyethyl]pent-4-enyl] benzoate |
|---|---|
| PubChem CID | 18652116 |
| Molecular Formula | C21H23BrO4 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [(2R)-2-[(1S)-2-[(4-bromophenyl)methoxy]-1-hydroxyethyl]pent-4-enyl] benzoate |
| SMILES | C=CC[C@H](COC(=O)c1ccccc1)[C@H](O)COCc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H23BrO4/c1-2-6-18(14-26-21(24)17-7-4-3-5-8-17)20(23)15-25-13-16-9-11-19(22)12-10-16/h2-5,7-12,18,20,23H,1,6,13-15H2/t18-,20-/m1/s1 |
| InChIKey | CWWAICVXERVJDM-UYAOXDASSA-N |
| XLogP | 4.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|